C14H18O4 — CID 59934417
2-[(E)-2-methoxy-1-[2-(methoxymethyl)phenyl]ethenyl]-1,3-dioxolane (PubChem CID 59934417) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-[(E)-2-methoxy-1-[2-(methoxymethyl)phenyl]ethenyl]-1,3-dioxolane.
| Compound Name | 2-[(E)-2-methoxy-1-[2-(methoxymethyl)phenyl]ethenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 59934417 |
| Molecular Formula | C14H18O4 |
| Molecular Weight | 250.29 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 2-[(E)-2-methoxy-1-[2-(methoxymethyl)phenyl]ethenyl]-1,3-dioxolane |
| SMILES | CO/C=C(\c1ccccc1COC)C1OCCO1 |
| InChI | InChI=1S/C14H18O4/c1-15-9-11-5-3-4-6-12(11)13(10-16-2)14-17-7-8-18-14/h3-6,10,14H,7-9H2,1-2H3/b13-10+ |
| InChIKey | RIOHHSYPAJNLNO-JLHYYAGUSA-N |
| XLogP | 2.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|