C16H15F16NO — CID 72623032
2-ethyl-N-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl)but-2-enamide (PubChem CID 72623032) has the molecular formula C16H15F16NO and a molecular weight of 541.27 g/mol. Its IUPAC name is 2-ethyl-N-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl)but-2-enamide.
| Compound Name | 2-ethyl-N-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl)but-2-enamide |
|---|---|
| PubChem CID | 72623032 |
| Molecular Formula | C16H15F16NO |
| Molecular Weight | 541.27 g/mol |
| Exact Mass | 541.09 |
| IUPAC Name | 2-ethyl-N-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10-hexadecafluorodecyl)but-2-enamide |
| SMILES | CC=C(CC)C(=O)NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C16H15F16NO/c1-3-7(4-2)8(34)33-6-5-10(19,20)12(23,24)14(27,28)16(31,32)15(29,30)13(25,26)11(21,22)9(17)18/h3,9H,4-6H2,1-2H3,(H,33,34) |
| InChIKey | IJPLPULIARYWDR-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.27 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|