C16H18F13NO — CID 59248250
2-methyl-N-(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl)prop-2-enamide (PubChem CID 59248250) has the molecular formula C16H18F13NO and a molecular weight of 487.30 g/mol. Its IUPAC name is 2-methyl-N-(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl)prop-2-enamide.
| Compound Name | 2-methyl-N-(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl)prop-2-enamide |
|---|---|
| PubChem CID | 59248250 |
| Molecular Formula | C16H18F13NO |
| Molecular Weight | 487.30 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 2-methyl-N-(7,7,8,8,9,9,10,10,11,11,12,12,12-tridecafluorododecyl)prop-2-enamide |
| SMILES | C=C(C)C(=O)NCCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H18F13NO/c1-9(2)10(31)30-8-6-4-3-5-7-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h1,3-8H2,2H3,(H,30,31) |
| InChIKey | CEDNOZJCJFNRJB-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.30 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|