C20H17NO3S3 — CID 72655463
4-[5-(3a,9b-dihydrobenzo[g][1]benzothiol-3-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 72655463) has the molecular formula C20H17NO3S3 and a molecular weight of 415.56 g/mol. Its IUPAC name is 4-[5-(3a,9b-dihydrobenzo[g][1]benzothiol-3-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[5-(3a,9b-dihydrobenzo[g][1]benzothiol-3-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 72655463 |
| Molecular Formula | C20H17NO3S3 |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 4-[5-(3a,9b-dihydrobenzo[g][1]benzothiol-3-ylmethylidene)-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C(=CC2=CSC3c4ccccc4C=CC23)SC1=S |
| InChI | InChI=1S/C20H17NO3S3/c22-17(23)6-3-9-21-19(24)16(27-20(21)25)10-13-11-26-18-14-5-2-1-4-12(14)7-8-15(13)18/h1-2,4-5,7-8,10-11,15,18H,3,6,9H2,(H,22,23) |
| InChIKey | YHWKEJHLZWFLGT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|