C15H21NO4S — CID 72656563
N-hydroxy-2-(2-phenylethylsulfonyl)cyclohexane-1-carboxamide (PubChem CID 72656563) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is N-hydroxy-2-(2-phenylethylsulfonyl)cyclohexane-1-carboxamide.
| Compound Name | N-hydroxy-2-(2-phenylethylsulfonyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 72656563 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-hydroxy-2-(2-phenylethylsulfonyl)cyclohexane-1-carboxamide |
| SMILES | O=C(NO)C1CCCCC1S(=O)(=O)CCc1ccccc1 |
| InChI | InChI=1S/C15H21NO4S/c17-15(16-18)13-8-4-5-9-14(13)21(19,20)11-10-12-6-2-1-3-7-12/h1-3,6-7,13-14,18H,4-5,8-11H2,(H,16,17) |
| InChIKey | ZHPYMNKKCCXESP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|