C41H62N4O5Si — CID 72658470
1-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]-3-[10-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoylamino]-5-(2-trimethoxysilylethyl)deca-2,8-dienyl]urea (PubChem CID 72658470) has the molecular formula C41H62N4O5Si and a molecular weight of 719.06 g/mol. Its IUPAC name is 1-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]-3-[10-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoylamino]-5-(2-trimethoxysilylethyl)deca-2,8-dienyl]urea.
| Compound Name | 1-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]-3-[10-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoylamino]-5-(2-trimethoxysilylethyl)deca-2,8-dienyl]urea |
|---|---|
| PubChem CID | 72658470 |
| Molecular Formula | C41H62N4O5Si |
| Molecular Weight | 719.06 g/mol |
| Exact Mass | 718.45 |
| IUPAC Name | 1-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]-3-[10-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoylamino]-5-(2-trimethoxysilylethyl)deca-2,8-dienyl]urea |
| SMILES | C=C(C)c1cccc(C(C)(C)NC(=O)NCC=CCCC(CC=CCNC(=O)NC(C)(C)c2cccc(C(=C)C)c2)CC[Si](OC)(OC)OC)c1 |
| InChI | InChI=1S/C41H62N4O5Si/c1-31(2)34-21-17-23-36(29-34)40(5,6)44-38(46)42-26-15-12-13-19-33(25-28-51(48-9,49-10)50-11)20-14-16-27-43-39(47)45-41(7,8)37-24-18-22-35(30-37)32(3)4/h12,14-18,21-24,29-30,33H,1,3,13,19-20,25-28H2,2,4-11H3,(H2,42,44,46)(H2,43,45,47) |
| InChIKey | GKVWJWBZXUCZGO-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 109.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.06 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|