C19H29NO2 — CID 72660160
2-[(2,6-dimethyl-10-methylidenedodeca-2,6,11-trienylidene)amino]ethyl acetate (PubChem CID 72660160) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-[(2,6-dimethyl-10-methylidenedodeca-2,6,11-trienylidene)amino]ethyl acetate.
| Compound Name | 2-[(2,6-dimethyl-10-methylidenedodeca-2,6,11-trienylidene)amino]ethyl acetate |
|---|---|
| PubChem CID | 72660160 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 2-[(2,6-dimethyl-10-methylidenedodeca-2,6,11-trienylidene)amino]ethyl acetate |
| SMILES | C=CC(=C)CCC=C(C)CCC=C(C)/C=N/CCOC(C)=O |
| InChI | InChI=1S/C19H29NO2/c1-6-16(2)9-7-10-17(3)11-8-12-18(4)15-20-13-14-22-19(5)21/h6,10,12,15H,1-2,7-9,11,13-14H2,3-5H3/b17-10?,18-12?,20-15+ |
| InChIKey | FKARTNWIMCHMAC-DJPBCXONSA-N |
| XLogP | 4.82 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|