C14H21NO2 — CID 72660174
2-(3,7-dimethylocta-2,4,6-trienylideneamino)ethyl acetate (PubChem CID 72660174) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(3,7-dimethylocta-2,4,6-trienylideneamino)ethyl acetate.
| Compound Name | 2-(3,7-dimethylocta-2,4,6-trienylideneamino)ethyl acetate |
|---|---|
| PubChem CID | 72660174 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-(3,7-dimethylocta-2,4,6-trienylideneamino)ethyl acetate |
| SMILES | CC(=O)OCC/N=C/C=C(C)C=CC=C(C)C |
| InChI | InChI=1S/C14H21NO2/c1-12(2)6-5-7-13(3)8-9-15-10-11-17-14(4)16/h5-9H,10-11H2,1-4H3/b7-5?,13-8?,15-9+ |
| InChIKey | RXMPRRXGXMEKIZ-OMNSVPCLSA-N |
| XLogP | 3.09 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|