C19H31NO2 — CID 72660185
2-(3,7,11-trimethyldodeca-2,6,10-trienylideneamino)ethyl acetate (PubChem CID 72660185) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 2-(3,7,11-trimethyldodeca-2,6,10-trienylideneamino)ethyl acetate.
| Compound Name | 2-(3,7,11-trimethyldodeca-2,6,10-trienylideneamino)ethyl acetate |
|---|---|
| PubChem CID | 72660185 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 2-(3,7,11-trimethyldodeca-2,6,10-trienylideneamino)ethyl acetate |
| SMILES | CC(=O)OCC/N=C/C=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C19H31NO2/c1-16(2)8-6-9-17(3)10-7-11-18(4)12-13-20-14-15-22-19(5)21/h8,10,12-13H,6-7,9,11,14-15H2,1-5H3/b17-10?,18-12?,20-13+ |
| InChIKey | AXAZLWHBHVYUPQ-WDZRWHMOSA-N |
| XLogP | 5.04 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|