C18H23N3O3 — CID 72662220
N-hydroxy-4-methyl-2-(naphthalen-1-ylmethylcarbamoylamino)pentanamide (PubChem CID 72662220) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-hydroxy-4-methyl-2-(naphthalen-1-ylmethylcarbamoylamino)pentanamide.
| Compound Name | N-hydroxy-4-methyl-2-(naphthalen-1-ylmethylcarbamoylamino)pentanamide |
|---|---|
| PubChem CID | 72662220 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-hydroxy-4-methyl-2-(naphthalen-1-ylmethylcarbamoylamino)pentanamide |
| SMILES | CC(C)CC(NC(=O)NCc1cccc2ccccc12)C(=O)NO |
| InChI | InChI=1S/C18H23N3O3/c1-12(2)10-16(17(22)21-24)20-18(23)19-11-14-8-5-7-13-6-3-4-9-15(13)14/h3-9,12,16,24H,10-11H2,1-2H3,(H,21,22)(H2,19,20,23) |
| InChIKey | RFGJRKGWQKGXJW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|