C18H17FN2O3 — CID 72684553
2-[3-(4-fluorophenyl)prop-2-enoylamino]-5-methoxy-N-methylbenzamide (PubChem CID 72684553) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)prop-2-enoylamino]-5-methoxy-N-methylbenzamide.
| Compound Name | 2-[3-(4-fluorophenyl)prop-2-enoylamino]-5-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 72684553 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[3-(4-fluorophenyl)prop-2-enoylamino]-5-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(OC)ccc1NC(=O)C=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN2O3/c1-20-18(23)15-11-14(24-2)8-9-16(15)21-17(22)10-5-12-3-6-13(19)7-4-12/h3-11H,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | URTQZQNGLAYFPN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|