C22H19FN2O3S — CID 72684548
2-[3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enoylamino]-5-methoxy-N-methylbenzamide (PubChem CID 72684548) has the molecular formula C22H19FN2O3S and a molecular weight of 410.47 g/mol. Its IUPAC name is 2-[3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enoylamino]-5-methoxy-N-methylbenzamide.
| Compound Name | 2-[3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enoylamino]-5-methoxy-N-methylbenzamide |
|---|---|
| PubChem CID | 72684548 |
| Molecular Formula | C22H19FN2O3S |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-[3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enoylamino]-5-methoxy-N-methylbenzamide |
| SMILES | CNC(=O)c1cc(OC)ccc1NC(=O)C=Cc1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C22H19FN2O3S/c1-24-22(27)18-13-16(28-2)7-10-19(18)25-21(26)12-9-17-8-11-20(29-17)14-3-5-15(23)6-4-14/h3-13H,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | VTXBCUDGVNICGO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|