C16H18Cl2N2O4S — CID 72687144
3-(3,4-dichlorophenyl)-N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]prop-2-enamide (PubChem CID 72687144) has the molecular formula C16H18Cl2N2O4S and a molecular weight of 405.30 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]prop-2-enamide.
| Compound Name | 3-(3,4-dichlorophenyl)-N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 72687144 |
| Molecular Formula | C16H18Cl2N2O4S |
| Molecular Weight | 405.30 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-N-[1-(1,1-dioxo-1,4-thiazinan-4-yl)-1-oxopropan-2-yl]prop-2-enamide |
| SMILES | CC(NC(=O)C=Cc1ccc(Cl)c(Cl)c1)C(=O)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C16H18Cl2N2O4S/c1-11(16(22)20-6-8-25(23,24)9-7-20)19-15(21)5-3-12-2-4-13(17)14(18)10-12/h2-5,10-11H,6-9H2,1H3,(H,19,21) |
| InChIKey | OINDQGKSXIGCSQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|