C21H28N2O3S — CID 72688482
3-(3,4-diethoxyphenyl)-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-N-methylprop-2-enamide (PubChem CID 72688482) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-N-methylprop-2-enamide.
| Compound Name | 3-(3,4-diethoxyphenyl)-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 72688482 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)-N-[1-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-N-methylprop-2-enamide |
| SMILES | CCOc1ccc(C=CC(=O)N(C)C(C)c2sc(C)nc2C)cc1OCC |
| InChI | InChI=1S/C21H28N2O3S/c1-7-25-18-11-9-17(13-19(18)26-8-2)10-12-20(24)23(6)15(4)21-14(3)22-16(5)27-21/h9-13,15H,7-8H2,1-6H3 |
| InChIKey | KSVQPGPSJLRYJO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|