C17H13BrN4O4 — CID 72690456
1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl 3-(3-nitrophenyl)prop-2-enoate (PubChem CID 72690456) has the molecular formula C17H13BrN4O4 and a molecular weight of 417.22 g/mol. Its IUPAC name is 1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl 3-(3-nitrophenyl)prop-2-enoate.
| Compound Name | 1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl 3-(3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 72690456 |
| Molecular Formula | C17H13BrN4O4 |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 1-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)ethyl 3-(3-nitrophenyl)prop-2-enoate |
| SMILES | CC(OC(=O)C=Cc1cccc([N+](=O)[O-])c1)c1nc2ncc(Br)cc2[nH]1 |
| InChI | InChI=1S/C17H13BrN4O4/c1-10(16-20-14-8-12(18)9-19-17(14)21-16)26-15(23)6-5-11-3-2-4-13(7-11)22(24)25/h2-10H,1H3,(H,19,20,21) |
| InChIKey | JGPGTQJUYBYDBO-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|