C24H28N2O2 — CID 72691195
N-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-3-methyl-5-phenylpent-2-enamide (PubChem CID 72691195) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is N-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-3-methyl-5-phenylpent-2-enamide.
| Compound Name | N-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-3-methyl-5-phenylpent-2-enamide |
|---|---|
| PubChem CID | 72691195 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | N-[4-(2,3-dihydroindol-1-yl)-4-oxobutyl]-3-methyl-5-phenylpent-2-enamide |
| SMILES | CC(=CC(=O)NCCCC(=O)N1CCc2ccccc21)CCc1ccccc1 |
| InChI | InChI=1S/C24H28N2O2/c1-19(13-14-20-8-3-2-4-9-20)18-23(27)25-16-7-12-24(28)26-17-15-21-10-5-6-11-22(21)26/h2-6,8-11,18H,7,12-17H2,1H3,(H,25,27) |
| InChIKey | HKYHDEZTNQULSB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|