C13H16F2N2O2S — CID 72691279
N-[3-(difluoromethylsulfanyl)phenyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide (PubChem CID 72691279) has the molecular formula C13H16F2N2O2S and a molecular weight of 302.35 g/mol. Its IUPAC name is N-[3-(difluoromethylsulfanyl)phenyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide.
| Compound Name | N-[3-(difluoromethylsulfanyl)phenyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 72691279 |
| Molecular Formula | C13H16F2N2O2S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-[3-(difluoromethylsulfanyl)phenyl]-2-(hydroxymethyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(SC(F)F)c1)N1CCCC1CO |
| InChI | InChI=1S/C13H16F2N2O2S/c14-12(15)20-11-5-1-3-9(7-11)16-13(19)17-6-2-4-10(17)8-18/h1,3,5,7,10,12,18H,2,4,6,8H2,(H,16,19) |
| InChIKey | JIUFACSHFJYKEM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |