C14H18N4O3S — CID 7269248
N-[(1R)-1-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-2-hydroxyethyl]-4-methoxybenzamide (PubChem CID 7269248) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is N-[(1R)-1-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-2-hydroxyethyl]-4-methoxybenzamide.
| Compound Name | N-[(1R)-1-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-2-hydroxyethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 7269248 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | N-[(1R)-1-(4-ethyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-2-hydroxyethyl]-4-methoxybenzamide |
| SMILES | CCn1c([C@H](CO)NC(=O)c2ccc(OC)cc2)n[nH]c1=S |
| InChI | InChI=1S/C14H18N4O3S/c1-3-18-12(16-17-14(18)22)11(8-19)15-13(20)9-4-6-10(21-2)7-5-9/h4-7,11,19H,3,8H2,1-2H3,(H,15,20)(H,17,22)/t11-/m0/s1 |
| InChIKey | ZDDMSQUDEHCEGV-NSHDSACASA-N |
| XLogP | 1.43 |
| TPSA | 92.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|