C25H35N3O — CID 72696629
(3E,8R,9S,10R,13S,14S,17R)-3-hydrazinylidene-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol (PubChem CID 72696629) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is (3E,8R,9S,10R,13S,14S,17R)-3-hydrazinylidene-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol.
| Compound Name | (3E,8R,9S,10R,13S,14S,17R)-3-hydrazinylidene-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
|---|---|
| PubChem CID | 72696629 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | (3E,8R,9S,10R,13S,14S,17R)-3-hydrazinylidene-10,13-dimethyl-17-(pyridin-2-ylmethyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-ol |
| SMILES | C[C@]12CC/C(=N\N)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(O)Cc1ccccn1 |
| InChI | InChI=1S/C25H35N3O/c1-23-11-8-18(28-26)15-17(23)6-7-20-21(23)9-12-24(2)22(20)10-13-25(24,29)16-19-5-3-4-14-27-19/h3-5,14-15,20-22,29H,6-13,16,26H2,1-2H3/b28-18+/t20-,21+,22+,23+,24+,25-/m1/s1 |
| InChIKey | YCOMVAIDIIQVJG-JSDOYMQCSA-N |
| XLogP | 4.63 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|