C27H24O6S — CID 72696960
[(2R,3S,3aR,6aS)-2-(hydroxymethyl)-3-(4-methylphenyl)sulfonyl-5-phenyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]-phenylmethanone (PubChem CID 72696960) has the molecular formula C27H24O6S and a molecular weight of 476.55 g/mol. Its IUPAC name is [(2R,3S,3aR,6aS)-2-(hydroxymethyl)-3-(4-methylphenyl)sulfonyl-5-phenyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]-phenylmethanone.
| Compound Name | [(2R,3S,3aR,6aS)-2-(hydroxymethyl)-3-(4-methylphenyl)sulfonyl-5-phenyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 72696960 |
| Molecular Formula | C27H24O6S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | [(2R,3S,3aR,6aS)-2-(hydroxymethyl)-3-(4-methylphenyl)sulfonyl-5-phenyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2[C@@H]3C(C(=O)c4ccccc4)=C(c4ccccc4)O[C@@H]3O[C@@H]2CO)cc1 |
| InChI | InChI=1S/C27H24O6S/c1-17-12-14-20(15-13-17)34(30,31)26-21(16-28)32-27-23(26)22(24(29)18-8-4-2-5-9-18)25(33-27)19-10-6-3-7-11-19/h2-15,21,23,26-28H,16H2,1H3/t21-,23+,26-,27+/m1/s1 |
| InChIKey | ABXPGIDKSZINQZ-JWRZUHOQSA-N |
| XLogP | 3.80 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |