C16H20O7S2 — CID 72697100
[(2R,3S,3aR,6aS)-5-methyl-3-(4-methylphenyl)sulfonyl-4-methylsulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-2-yl]methanol (PubChem CID 72697100) has the molecular formula C16H20O7S2 and a molecular weight of 388.46 g/mol. Its IUPAC name is [(2R,3S,3aR,6aS)-5-methyl-3-(4-methylphenyl)sulfonyl-4-methylsulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-2-yl]methanol.
| Compound Name | [(2R,3S,3aR,6aS)-5-methyl-3-(4-methylphenyl)sulfonyl-4-methylsulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-2-yl]methanol |
|---|---|
| PubChem CID | 72697100 |
| Molecular Formula | C16H20O7S2 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | [(2R,3S,3aR,6aS)-5-methyl-3-(4-methylphenyl)sulfonyl-4-methylsulfonyl-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-2-yl]methanol |
| SMILES | CC1=C(S(C)(=O)=O)[C@@H]2[C@H](O1)O[C@H](CO)[C@H]2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H20O7S2/c1-9-4-6-11(7-5-9)25(20,21)15-12(8-17)23-16-13(15)14(10(2)22-16)24(3,18)19/h4-7,12-13,15-17H,8H2,1-3H3/t12-,13+,15-,16-/m1/s1 |
| InChIKey | UEPTVQVEGCNWFG-OCVGTWLNSA-N |
| XLogP | 0.78 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |