C19H21BrO4 — CID 72697536
methyl (3S,4S,4aS,8aS)-4-[(E)-2-(4-bromophenyl)ethenyl]-2-oxo-3,4,4a,5,6,7,8,8a-octahydrochromene-3-carboxylate (PubChem CID 72697536) has the molecular formula C19H21BrO4 and a molecular weight of 393.28 g/mol. Its IUPAC name is methyl (3S,4S,4aS,8aS)-4-[(E)-2-(4-bromophenyl)ethenyl]-2-oxo-3,4,4a,5,6,7,8,8a-octahydrochromene-3-carboxylate.
| Compound Name | methyl (3S,4S,4aS,8aS)-4-[(E)-2-(4-bromophenyl)ethenyl]-2-oxo-3,4,4a,5,6,7,8,8a-octahydrochromene-3-carboxylate |
|---|---|
| PubChem CID | 72697536 |
| Molecular Formula | C19H21BrO4 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | methyl (3S,4S,4aS,8aS)-4-[(E)-2-(4-bromophenyl)ethenyl]-2-oxo-3,4,4a,5,6,7,8,8a-octahydrochromene-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)O[C@H]2CCCC[C@H]2[C@@H]1/C=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H21BrO4/c1-23-18(21)17-15(11-8-12-6-9-13(20)10-7-12)14-4-2-3-5-16(14)24-19(17)22/h6-11,14-17H,2-5H2,1H3/b11-8+/t14-,15-,16-,17-/m0/s1 |
| InChIKey | YNBYELNXSZRVJD-BKMSRMEISA-N |
| XLogP | 3.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|