C14H10FNO4S — CID 72698545
(1E)-1-[[5-(4-fluoro-2-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 72698545) has the molecular formula C14H10FNO4S and a molecular weight of 307.30 g/mol. Its IUPAC name is (1E)-1-[[5-(4-fluoro-2-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (1E)-1-[[5-(4-fluoro-2-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 72698545 |
| Molecular Formula | C14H10FNO4S |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | (1E)-1-[[5-(4-fluoro-2-hydroxyphenyl)furan-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1C/S(=C\c2ccc(-c3ccc(F)cc3O)o2)C(=O)N1 |
| InChI | InChI=1S/C14H10FNO4S/c15-8-1-3-10(11(17)5-8)12-4-2-9(20-12)6-21-7-13(18)16-14(21)19/h1-6,17H,7H2,(H,16,18,19) |
| InChIKey | HWIQSZPIZTVKNA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|