C19H25BrN2O3 — CID 7269868
(1S,6S,7R)-N-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 7269868) has the molecular formula C19H25BrN2O3 and a molecular weight of 409.32 g/mol. Its IUPAC name is (1S,6S,7R)-N-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1S,6S,7R)-N-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 7269868 |
| Molecular Formula | C19H25BrN2O3 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (1S,6S,7R)-N-[(Z)-(3-bromo-4-ethoxy-5-methoxyphenyl)methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | CCOc1c(Br)cc(/C=N\NC(=O)[C@@H]2[C@@H]3CCCC[C@]23C)cc1OC |
| InChI | InChI=1S/C19H25BrN2O3/c1-4-25-17-14(20)9-12(10-15(17)24-3)11-21-22-18(23)16-13-7-5-6-8-19(13,16)2/h9-11,13,16H,4-8H2,1-3H3,(H,22,23)/b21-11-/t13-,16-,19-/m0/s1 |
| InChIKey | TUJIRKNYLPUZRG-GRGXEIBBSA-N |
| XLogP | 4.13 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|