C25H28ClIN2O3 — CID 98660656
(1R,6S,7R)-N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 98660656) has the molecular formula C25H28ClIN2O3 and a molecular weight of 566.87 g/mol. Its IUPAC name is (1R,6S,7R)-N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1R,6S,7R)-N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 98660656 |
| Molecular Formula | C25H28ClIN2O3 |
| Molecular Weight | 566.87 g/mol |
| Exact Mass | 566.08 |
| IUPAC Name | (1R,6S,7R)-N-[(Z)-[4-[(2-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | CCOc1cc(/C=N\NC(=O)[C@@H]2[C@@H]3CCCC[C@@]23C)cc(I)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C25H28ClIN2O3/c1-3-31-21-13-16(12-20(27)23(21)32-15-17-8-4-5-10-19(17)26)14-28-29-24(30)22-18-9-6-7-11-25(18,22)2/h4-5,8,10,12-14,18,22H,3,6-7,9,11,15H2,1-2H3,(H,29,30)/b28-14-/t18-,22-,25+/m0/s1 |
| InChIKey | YNXICOCVPAIGGY-AKQWOQEXSA-N |
| XLogP | 6.20 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.87 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|