C28H29IN2O3 — CID 98660652
(1R,6R,7R)-N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 98660652) has the molecular formula C28H29IN2O3 and a molecular weight of 568.46 g/mol. Its IUPAC name is (1R,6R,7R)-N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | (1R,6R,7R)-N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 98660652 |
| Molecular Formula | C28H29IN2O3 |
| Molecular Weight | 568.46 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | (1R,6R,7R)-N-[(Z)-[3-iodo-5-methoxy-4-(naphthalen-1-ylmethoxy)phenyl]methylideneamino]-1-methylbicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)[C@@H]2[C@H]3CCCC[C@]32C)cc(I)c1OCc1cccc2ccccc12 |
| InChI | InChI=1S/C28H29IN2O3/c1-28-13-6-5-12-22(28)25(28)27(32)31-30-16-18-14-23(29)26(24(15-18)33-2)34-17-20-10-7-9-19-8-3-4-11-21(19)20/h3-4,7-11,14-16,22,25H,5-6,12-13,17H2,1-2H3,(H,31,32)/b30-16-/t22-,25+,28-/m1/s1 |
| InChIKey | UJZMKWVGOSSGKV-BHOSFWNRSA-N |
| XLogP | 6.31 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.46 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|