C21H24N4O3 — CID 7269941
4-[2-[(2R)-2-methylcyclohexylidene]hydrazinyl]-N-(4-methylphenyl)-3-nitrobenzamide (PubChem CID 7269941) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-[2-[(2R)-2-methylcyclohexylidene]hydrazinyl]-N-(4-methylphenyl)-3-nitrobenzamide.
| Compound Name | 4-[2-[(2R)-2-methylcyclohexylidene]hydrazinyl]-N-(4-methylphenyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 7269941 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-[2-[(2R)-2-methylcyclohexylidene]hydrazinyl]-N-(4-methylphenyl)-3-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(NN=C3CCCC[C@H]3C)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H24N4O3/c1-14-7-10-17(11-8-14)22-21(26)16-9-12-19(20(13-16)25(27)28)24-23-18-6-4-3-5-15(18)2/h7-13,15,24H,3-6H2,1-2H3,(H,22,26)/t15-/m1/s1 |
| InChIKey | KUYJRVDKGSMKAV-OAHLLOKOSA-N |
| XLogP | 5.13 |
| TPSA | 96.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|