C24H31N3O5 — CID 72701162
(2S)-N-tert-butyl-2-(4-methoxyanilino)-2-[(2S,3R)-3-methoxy-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]acetamide (PubChem CID 72701162) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is (2S)-N-tert-butyl-2-(4-methoxyanilino)-2-[(2S,3R)-3-methoxy-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]acetamide.
| Compound Name | (2S)-N-tert-butyl-2-(4-methoxyanilino)-2-[(2S,3R)-3-methoxy-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]acetamide |
|---|---|
| PubChem CID | 72701162 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | (2S)-N-tert-butyl-2-(4-methoxyanilino)-2-[(2S,3R)-3-methoxy-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]acetamide |
| SMILES | COc1ccc(N[C@H](C(=O)NC(C)(C)C)[C@H]2[C@@H](OC)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C24H31N3O5/c1-24(2,3)26-22(28)19(25-15-7-11-17(30-4)12-8-15)20-21(32-6)23(29)27(20)16-9-13-18(31-5)14-10-16/h7-14,19-21,25H,1-6H3,(H,26,28)/t19-,20-,21+/m0/s1 |
| InChIKey | SXWGRXKMXZCCKV-PCCBWWKXSA-N |
| XLogP | 2.83 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|