C18H31NO3 — CID 72701450
prop-2-enyl (3R,5R)-3-ethenyl-5-nonyl-1,2-oxazolidine-2-carboxylate (PubChem CID 72701450) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is prop-2-enyl (3R,5R)-3-ethenyl-5-nonyl-1,2-oxazolidine-2-carboxylate.
| Compound Name | prop-2-enyl (3R,5R)-3-ethenyl-5-nonyl-1,2-oxazolidine-2-carboxylate |
|---|---|
| PubChem CID | 72701450 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | prop-2-enyl (3R,5R)-3-ethenyl-5-nonyl-1,2-oxazolidine-2-carboxylate |
| SMILES | C=CCOC(=O)N1O[C@H](CCCCCCCCC)C[C@@H]1C=C |
| InChI | InChI=1S/C18H31NO3/c1-4-7-8-9-10-11-12-13-17-15-16(6-3)19(22-17)18(20)21-14-5-2/h5-6,16-17H,2-4,7-15H2,1H3/t16-,17+/m0/s1 |
| InChIKey | KGMLEWNTLFHEBJ-DLBZAZTESA-N |
| XLogP | 5.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|