C22H26O6 — CID 72707434
(3R,4R)-5,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-one (PubChem CID 72707434) has the molecular formula C22H26O6 and a molecular weight of 386.44 g/mol. Its IUPAC name is (3R,4R)-5,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-one.
| Compound Name | (3R,4R)-5,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 72707434 |
| Molecular Formula | C22H26O6 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (3R,4R)-5,5-bis(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-one |
| SMILES | COc1ccc(C2(c3ccc(OC)c(OC)c3)OC(=O)[C@H](C)[C@H]2C)cc1OC |
| InChI | InChI=1S/C22H26O6/c1-13-14(2)22(28-21(13)23,15-7-9-17(24-3)19(11-15)26-5)16-8-10-18(25-4)20(12-16)27-6/h7-14H,1-6H3/t13-,14-/m1/s1 |
| InChIKey | VIZKKTSPRHXKQA-ZIAGYGMSSA-N |
| XLogP | 3.79 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |