C5H8INOS — CID 72707557
(5R)-5-(2-iodoethyl)-1,3-oxazolidine-2-thione (PubChem CID 72707557) has the molecular formula C5H8INOS and a molecular weight of 257.10 g/mol. Its IUPAC name is (5R)-5-(2-iodoethyl)-1,3-oxazolidine-2-thione.
| Compound Name | (5R)-5-(2-iodoethyl)-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 72707557 |
| Molecular Formula | C5H8INOS |
| Molecular Weight | 257.10 g/mol |
| Exact Mass | 256.94 |
| IUPAC Name | (5R)-5-(2-iodoethyl)-1,3-oxazolidine-2-thione |
| SMILES | S=C1NC[C@@H](CCI)O1 |
| InChI | InChI=1S/C5H8INOS/c6-2-1-4-3-7-5(9)8-4/h4H,1-3H2,(H,7,9)/t4-/m1/s1 |
| InChIKey | SMDQDTMPDREGLP-SCSAIBSYSA-N |
| XLogP | 1.08 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.10 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|