C11H14O5 — CID 72707835
methyl (2E)-2-[(5R)-5-ethynyl-2-methoxy-2,5-dimethyl-1,3-dioxolan-4-ylidene]acetate (PubChem CID 72707835) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl (2E)-2-[(5R)-5-ethynyl-2-methoxy-2,5-dimethyl-1,3-dioxolan-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(5R)-5-ethynyl-2-methoxy-2,5-dimethyl-1,3-dioxolan-4-ylidene]acetate |
|---|---|
| PubChem CID | 72707835 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | methyl (2E)-2-[(5R)-5-ethynyl-2-methoxy-2,5-dimethyl-1,3-dioxolan-4-ylidene]acetate |
| SMILES | C#C[C@@]1(C)OC(C)(OC)O/C1=C/C(=O)OC |
| InChI | InChI=1S/C11H14O5/c1-6-10(2)8(7-9(12)13-4)15-11(3,14-5)16-10/h1,7H,2-5H3/b8-7+/t10-,11?/m1/s1 |
| InChIKey | TWMPYZBVFXAVIQ-IQCDDQRWSA-N |
| XLogP | 0.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|