C19H14ClN3O5S — CID 72708913
3-(4-chloro-N-[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]anilino)propanoic acid (PubChem CID 72708913) has the molecular formula C19H14ClN3O5S and a molecular weight of 431.86 g/mol. Its IUPAC name is 3-(4-chloro-N-[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]anilino)propanoic acid.
| Compound Name | 3-(4-chloro-N-[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]anilino)propanoic acid |
|---|---|
| PubChem CID | 72708913 |
| Molecular Formula | C19H14ClN3O5S |
| Molecular Weight | 431.86 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 3-(4-chloro-N-[(5Z)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]anilino)propanoic acid |
| SMILES | O=C(O)CCN(C1=NC(=O)/C(=C/c2ccc([N+](=O)[O-])cc2)S1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14ClN3O5S/c20-13-3-7-14(8-4-13)22(10-9-17(24)25)19-21-18(26)16(29-19)11-12-1-5-15(6-2-12)23(27)28/h1-8,11H,9-10H2,(H,24,25)/b16-11- |
| InChIKey | BLTGYMBAWWLYDW-WJDWOHSUSA-N |
| XLogP | 4.20 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.86 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|