C20H24N2O5 — CID 7270944
methyl N-[(Z)-[3-methoxy-4-[(2R)-2-methyl-3-phenoxypropoxy]phenyl]methylideneamino]carbamate (PubChem CID 7270944) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is methyl N-[(Z)-[3-methoxy-4-[(2R)-2-methyl-3-phenoxypropoxy]phenyl]methylideneamino]carbamate.
| Compound Name | methyl N-[(Z)-[3-methoxy-4-[(2R)-2-methyl-3-phenoxypropoxy]phenyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 7270944 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | methyl N-[(Z)-[3-methoxy-4-[(2R)-2-methyl-3-phenoxypropoxy]phenyl]methylideneamino]carbamate |
| SMILES | COC(=O)N/N=C\c1ccc(OC[C@H](C)COc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C20H24N2O5/c1-15(13-26-17-7-5-4-6-8-17)14-27-18-10-9-16(11-19(18)24-2)12-21-22-20(23)25-3/h4-12,15H,13-14H2,1-3H3,(H,22,23)/b21-12-/t15-/m1/s1 |
| InChIKey | WUUPORPFJXHWQE-OFNOZLENSA-N |
| XLogP | 3.48 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|