C27H53N5O6 — CID 72710573
(2S)-N-[(4S)-2-amino-3,3-dihydroxy-2,6-dimethylheptan-4-yl]-2-[[(2S)-2-(hexanoylamino)-3-methylbutanoyl]amino]-N',N'-dimethylpentanediamide (PubChem CID 72710573) has the molecular formula C27H53N5O6 and a molecular weight of 543.75 g/mol. Its IUPAC name is (2S)-N-[(4S)-2-amino-3,3-dihydroxy-2,6-dimethylheptan-4-yl]-2-[[(2S)-2-(hexanoylamino)-3-methylbutanoyl]amino]-N',N'-dimethylpentanediamide.
| Compound Name | (2S)-N-[(4S)-2-amino-3,3-dihydroxy-2,6-dimethylheptan-4-yl]-2-[[(2S)-2-(hexanoylamino)-3-methylbutanoyl]amino]-N',N'-dimethylpentanediamide |
|---|---|
| PubChem CID | 72710573 |
| Molecular Formula | C27H53N5O6 |
| Molecular Weight | 543.75 g/mol |
| Exact Mass | 543.40 |
| IUPAC Name | (2S)-N-[(4S)-2-amino-3,3-dihydroxy-2,6-dimethylheptan-4-yl]-2-[[(2S)-2-(hexanoylamino)-3-methylbutanoyl]amino]-N',N'-dimethylpentanediamide |
| SMILES | CCCCCC(=O)N[C@H](C(=O)N[C@@H](CCC(=O)N(C)C)C(=O)N[C@@H](CC(C)C)C(O)(O)C(C)(C)N)C(C)C |
| InChI | InChI=1S/C27H53N5O6/c1-10-11-12-13-21(33)31-23(18(4)5)25(36)29-19(14-15-22(34)32(8)9)24(35)30-20(16-17(2)3)27(37,38)26(6,7)28/h17-20,23,37-38H,10-16,28H2,1-9H3,(H,29,36)(H,30,35)(H,31,33)/t19-,20-,23-/m0/s1 |
| InChIKey | RZEWQMAPLVPROS-JTAQYXEDSA-N |
| XLogP | 1.01 |
| TPSA | 174.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.75 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|