C28H55N5O6 — CID 74983342
(2S)-N-[(4S,6S)-6-amino-5,5-dihydroxy-2,6-dimethyloctan-4-yl]-2-[[(2S)-2-(hexanoylamino)-3-methylbutanoyl]amino]-N',N'-dimethylpentanediamide (PubChem CID 74983342) has the molecular formula C28H55N5O6 and a molecular weight of 557.78 g/mol. Its IUPAC name is (2S)-N-[(4S,6S)-6-amino-5,5-dihydroxy-2,6-dimethyloctan-4-yl]-2-[[(2S)-2-(hexanoylamino)-3-methylbutanoyl]amino]-N',N'-dimethylpentanediamide.
| Compound Name | (2S)-N-[(4S,6S)-6-amino-5,5-dihydroxy-2,6-dimethyloctan-4-yl]-2-[[(2S)-2-(hexanoylamino)-3-methylbutanoyl]amino]-N',N'-dimethylpentanediamide |
|---|---|
| PubChem CID | 74983342 |
| Molecular Formula | C28H55N5O6 |
| Molecular Weight | 557.78 g/mol |
| Exact Mass | 557.42 |
| IUPAC Name | (2S)-N-[(4S,6S)-6-amino-5,5-dihydroxy-2,6-dimethyloctan-4-yl]-2-[[(2S)-2-(hexanoylamino)-3-methylbutanoyl]amino]-N',N'-dimethylpentanediamide |
| SMILES | CCCCCC(=O)N[C@H](C(=O)N[C@@H](CCC(=O)N(C)C)C(=O)N[C@@H](CC(C)C)C(O)(O)[C@@](C)(N)CC)C(C)C |
| InChI | InChI=1S/C28H55N5O6/c1-10-12-13-14-22(34)32-24(19(5)6)26(37)30-20(15-16-23(35)33(8)9)25(36)31-21(17-18(3)4)28(38,39)27(7,29)11-2/h18-21,24,38-39H,10-17,29H2,1-9H3,(H,30,37)(H,31,36)(H,32,34)/t20-,21-,24-,27-/m0/s1 |
| InChIKey | RZJLTFRYRFRXDL-GNDQFBHHSA-N |
| XLogP | 1.40 |
| TPSA | 174.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.78 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|