C21H32ClN3O3 — CID 72711492
2-[4-[4-(2-methoxyphenyl)butylamino]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride (PubChem CID 72711492) has the molecular formula C21H32ClN3O3 and a molecular weight of 409.96 g/mol. Its IUPAC name is 2-[4-[4-(2-methoxyphenyl)butylamino]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride.
| Compound Name | 2-[4-[4-(2-methoxyphenyl)butylamino]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 72711492 |
| Molecular Formula | C21H32ClN3O3 |
| Molecular Weight | 409.96 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | 2-[4-[4-(2-methoxyphenyl)butylamino]butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione;hydrochloride |
| SMILES | COc1ccccc1CCCCNCCCCN1C(=O)C2CCCN2C1=O.Cl |
| InChI | InChI=1S/C21H31N3O3.ClH/c1-27-19-12-3-2-9-17(19)10-4-5-13-22-14-6-7-15-24-20(25)18-11-8-16-23(18)21(24)26;/h2-3,9,12,18,22H,4-8,10-11,13-16H2,1H3;1H |
| InChIKey | YYUYWFGKAUWUPE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.96 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|