C22H27N3O3 — CID 73355393
2-[4-(2-naphthalen-2-yloxyethylamino)butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 73355393) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[4-(2-naphthalen-2-yloxyethylamino)butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | 2-[4-(2-naphthalen-2-yloxyethylamino)butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 73355393 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 2-[4-(2-naphthalen-2-yloxyethylamino)butyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | O=C1C2CCCN2C(=O)N1CCCCNCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H27N3O3/c26-21-20-8-5-14-24(20)22(27)25(21)13-4-3-11-23-12-15-28-19-10-9-17-6-1-2-7-18(17)16-19/h1-2,6-7,9-10,16,20,23H,3-5,8,11-15H2 |
| InChIKey | ATXMAJPZWMYNTG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|