C27H23FN2O2 — CID 72712025
(4-fluorophenyl)-[5-(4-phenoxyphenyl)-2-(propylamino)-3-pyridinyl]methanone (PubChem CID 72712025) has the molecular formula C27H23FN2O2 and a molecular weight of 426.49 g/mol. Its IUPAC name is (4-fluorophenyl)-[5-(4-phenoxyphenyl)-2-(propylamino)-3-pyridinyl]methanone.
| Compound Name | (4-fluorophenyl)-[5-(4-phenoxyphenyl)-2-(propylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 72712025 |
| Molecular Formula | C27H23FN2O2 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | (4-fluorophenyl)-[5-(4-phenoxyphenyl)-2-(propylamino)-3-pyridinyl]methanone |
| SMILES | CCCNc1ncc(-c2ccc(Oc3ccccc3)cc2)cc1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H23FN2O2/c1-2-16-29-27-25(26(31)20-8-12-22(28)13-9-20)17-21(18-30-27)19-10-14-24(15-11-19)32-23-6-4-3-5-7-23/h3-15,17-18H,2,16H2,1H3,(H,29,30) |
| InChIKey | YCLGAWLPBXLTAM-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |