C39H30O5 — CID 58858848
[2-[4-(4-methoxyphenyl)phenoxy]-5-methylphenyl]-[4-(4-phenoxyphenoxy)phenyl]methanone (PubChem CID 58858848) has the molecular formula C39H30O5 and a molecular weight of 578.66 g/mol. Its IUPAC name is [2-[4-(4-methoxyphenyl)phenoxy]-5-methylphenyl]-[4-(4-phenoxyphenoxy)phenyl]methanone.
| Compound Name | [2-[4-(4-methoxyphenyl)phenoxy]-5-methylphenyl]-[4-(4-phenoxyphenoxy)phenyl]methanone |
|---|---|
| PubChem CID | 58858848 |
| Molecular Formula | C39H30O5 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | [2-[4-(4-methoxyphenyl)phenoxy]-5-methylphenyl]-[4-(4-phenoxyphenoxy)phenyl]methanone |
| SMILES | COc1ccc(-c2ccc(Oc3ccc(C)cc3C(=O)c3ccc(Oc4ccc(Oc5ccccc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H30O5/c1-27-8-25-38(44-36-17-11-29(12-18-36)28-9-15-31(41-2)16-10-28)37(26-27)39(40)30-13-19-33(20-14-30)43-35-23-21-34(22-24-35)42-32-6-4-3-5-7-32/h3-26H,1-2H3 |
| InChIKey | DKOWICDASWAFSP-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |