C29H30BrN3O3 — CID 72715430
N-[3-[4-(3-acetamidophenyl)piperidin-1-yl]propyl]-5-bromobenzo[g][1]benzofuran-2-carboxamide (PubChem CID 72715430) has the molecular formula C29H30BrN3O3 and a molecular weight of 548.48 g/mol. Its IUPAC name is N-[3-[4-(3-acetamidophenyl)piperidin-1-yl]propyl]-5-bromobenzo[g][1]benzofuran-2-carboxamide.
| Compound Name | N-[3-[4-(3-acetamidophenyl)piperidin-1-yl]propyl]-5-bromobenzo[g][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 72715430 |
| Molecular Formula | C29H30BrN3O3 |
| Molecular Weight | 548.48 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | N-[3-[4-(3-acetamidophenyl)piperidin-1-yl]propyl]-5-bromobenzo[g][1]benzofuran-2-carboxamide |
| SMILES | CC(=O)Nc1cccc(C2CCN(CCCNC(=O)c3cc4cc(Br)c5ccccc5c4o3)CC2)c1 |
| InChI | InChI=1S/C29H30BrN3O3/c1-19(34)32-23-7-4-6-21(16-23)20-10-14-33(15-11-20)13-5-12-31-29(35)27-18-22-17-26(30)24-8-2-3-9-25(24)28(22)36-27/h2-4,6-9,16-18,20H,5,10-15H2,1H3,(H,31,35)(H,32,34) |
| InChIKey | KCYCMNAXTBJNFZ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.48 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|