C35H34FN3O3 — CID 71679421
N-[3-[4-(3-acetamidophenyl)piperidin-1-yl]propyl]-5-(4-fluorophenyl)benzo[g][1]benzofuran-2-carboxamide (PubChem CID 71679421) has the molecular formula C35H34FN3O3 and a molecular weight of 563.67 g/mol. Its IUPAC name is N-[3-[4-(3-acetamidophenyl)piperidin-1-yl]propyl]-5-(4-fluorophenyl)benzo[g][1]benzofuran-2-carboxamide.
| Compound Name | N-[3-[4-(3-acetamidophenyl)piperidin-1-yl]propyl]-5-(4-fluorophenyl)benzo[g][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 71679421 |
| Molecular Formula | C35H34FN3O3 |
| Molecular Weight | 563.67 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | N-[3-[4-(3-acetamidophenyl)piperidin-1-yl]propyl]-5-(4-fluorophenyl)benzo[g][1]benzofuran-2-carboxamide |
| SMILES | CC(=O)Nc1cccc(C2CCN(CCCNC(=O)c3cc4cc(-c5ccc(F)cc5)c5ccccc5c4o3)CC2)c1 |
| InChI | InChI=1S/C35H34FN3O3/c1-23(40)38-29-7-4-6-26(20-29)24-14-18-39(19-15-24)17-5-16-37-35(41)33-22-27-21-32(25-10-12-28(36)13-11-25)30-8-2-3-9-31(30)34(27)42-33/h2-4,6-13,20-22,24H,5,14-19H2,1H3,(H,37,41)(H,38,40) |
| InChIKey | MAQXBHLKDHVVLN-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.67 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|