C12H17N5 — CID 72715650
3-N-(3-tert-butylphenyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 72715650) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-N-(3-tert-butylphenyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-(3-tert-butylphenyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 72715650 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 3-N-(3-tert-butylphenyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CC(C)(C)c1cccc(Nc2n[nH]c(N)n2)c1 |
| InChI | InChI=1S/C12H17N5/c1-12(2,3)8-5-4-6-9(7-8)14-11-15-10(13)16-17-11/h4-7H,1-3H3,(H4,13,14,15,16,17) |
| InChIKey | OOVARUNYUYFQTO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |