C19H26N4O3S — CID 72717135
4-ethyl-2-(2-methoxyethyl)-5-[1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-4-yl]-1,2,4-triazol-3-one (PubChem CID 72717135) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is 4-ethyl-2-(2-methoxyethyl)-5-[1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-4-yl]-1,2,4-triazol-3-one.
| Compound Name | 4-ethyl-2-(2-methoxyethyl)-5-[1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-4-yl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 72717135 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 4-ethyl-2-(2-methoxyethyl)-5-[1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidin-4-yl]-1,2,4-triazol-3-one |
| SMILES | CCn1c(C2CCN(C(=O)/C=C/c3cccs3)CC2)nn(CCOC)c1=O |
| InChI | InChI=1S/C19H26N4O3S/c1-3-22-18(20-23(19(22)25)12-13-26-2)15-8-10-21(11-9-15)17(24)7-6-16-5-4-14-27-16/h4-7,14-15H,3,8-13H2,1-2H3/b7-6+ |
| InChIKey | ZKKICYBQBRCCPJ-VOTSOKGWSA-N |
| XLogP | 2.19 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|