C14H14N4O2S — CID 72717863
N-(furan-2-ylmethyl)-1-methyl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide (PubChem CID 72717863) has the molecular formula C14H14N4O2S and a molecular weight of 302.36 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-methyl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-methyl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 72717863 |
| Molecular Formula | C14H14N4O2S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-methyl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)N(Cc2ccsc2)Cc2ccco2)nn1 |
| InChI | InChI=1S/C14H14N4O2S/c1-17-9-13(15-16-17)14(19)18(7-11-4-6-21-10-11)8-12-3-2-5-20-12/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | GHERJHGJHWMOQW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |