C12H12N4 — CID 7271850
2-imino-4,6,6-trimethylcyclohex-4-ene-1,1,3-tricarbonitrile (PubChem CID 7271850) has the molecular formula C12H12N4 and a molecular weight of 212.26 g/mol. Its IUPAC name is 2-imino-4,6,6-trimethylcyclohex-4-ene-1,1,3-tricarbonitrile.
| Compound Name | 2-imino-4,6,6-trimethylcyclohex-4-ene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 7271850 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 2-imino-4,6,6-trimethylcyclohex-4-ene-1,1,3-tricarbonitrile |
| SMILES | [H]/N=C1\C(C#N)C(C)=CC(C)(C)C1(C#N)C#N |
| InChI | InChI=1S/C12H12N4/c1-8-4-11(2,3)12(6-14,7-15)10(16)9(8)5-13/h4,9,16H,1-3H3/b16-10+ |
| InChIKey | AMMPRJQNWQYQSM-MHWRWJLKSA-N |
| XLogP | 2.17 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|