C17H26N2 — CID 91556387
2-(2-ethanimidoyl-4,4-dimethylcyclohexen-1-yl)-4-methylhex-3-enenitrile (PubChem CID 91556387) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-(2-ethanimidoyl-4,4-dimethylcyclohexen-1-yl)-4-methylhex-3-enenitrile.
| Compound Name | 2-(2-ethanimidoyl-4,4-dimethylcyclohexen-1-yl)-4-methylhex-3-enenitrile |
|---|---|
| PubChem CID | 91556387 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 2-(2-ethanimidoyl-4,4-dimethylcyclohexen-1-yl)-4-methylhex-3-enenitrile |
| SMILES | [H]/N=C(\C)C1=C(C(C#N)C=C(C)CC)CCC(C)(C)C1 |
| InChI | InChI=1S/C17H26N2/c1-6-12(2)9-14(11-18)15-7-8-17(4,5)10-16(15)13(3)19/h9,14,19H,6-8,10H2,1-5H3/b12-9?,19-13+ |
| InChIKey | LHCVZDAJWVEEIE-YQYYSUQYSA-N |
| XLogP | 5.03 |
| TPSA | 47.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|