C24H28N6 — CID 123395344
2-[3-[2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethylimino]-5,5-dimethylcyclohexen-1-yl]propanedinitrile (PubChem CID 123395344) has the molecular formula C24H28N6 and a molecular weight of 400.53 g/mol. Its IUPAC name is 2-[3-[2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethylimino]-5,5-dimethylcyclohexen-1-yl]propanedinitrile.
| Compound Name | 2-[3-[2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethylimino]-5,5-dimethylcyclohexen-1-yl]propanedinitrile |
|---|---|
| PubChem CID | 123395344 |
| Molecular Formula | C24H28N6 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 2-[3-[2-[[3-(dicyanomethyl)-5,5-dimethylcyclohex-2-en-1-ylidene]amino]ethylimino]-5,5-dimethylcyclohexen-1-yl]propanedinitrile |
| SMILES | CC1(C)CC(C(C#N)C#N)=C/C(=N\CC/N=C2\C=C(C(C#N)C#N)CC(C)(C)C2)C1 |
| InChI | InChI=1S/C24H28N6/c1-23(2)9-17(19(13-25)14-26)7-21(11-23)29-5-6-30-22-8-18(20(15-27)16-28)10-24(3,4)12-22/h7-8,19-20H,5-6,9-12H2,1-4H3/b29-21+,30-22+ |
| InChIKey | XRBLCHSPVQTOOI-VFIVCBTMSA-N |
| XLogP | 4.69 |
| TPSA | 119.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|