C14H17N3 — CID 123601282
2-(5,5-dimethyl-3-prop-2-enyliminocyclohexen-1-yl)propanedinitrile (PubChem CID 123601282) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-(5,5-dimethyl-3-prop-2-enyliminocyclohexen-1-yl)propanedinitrile.
| Compound Name | 2-(5,5-dimethyl-3-prop-2-enyliminocyclohexen-1-yl)propanedinitrile |
|---|---|
| PubChem CID | 123601282 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-(5,5-dimethyl-3-prop-2-enyliminocyclohexen-1-yl)propanedinitrile |
| SMILES | C=CC/N=C1\C=C(C(C#N)C#N)CC(C)(C)C1 |
| InChI | InChI=1S/C14H17N3/c1-4-5-17-13-6-11(12(9-15)10-16)7-14(2,3)8-13/h4,6,12H,1,5,7-8H2,2-3H3/b17-13+ |
| InChIKey | LVQQRZBTVSXSEB-GHRIWEEISA-N |
| XLogP | 3.02 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|