C19H29N3 — CID 123137506
2-[3-(2-ethylhexylimino)-5,5-dimethylcyclohexen-1-yl]propanedinitrile (PubChem CID 123137506) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is 2-[3-(2-ethylhexylimino)-5,5-dimethylcyclohexen-1-yl]propanedinitrile.
| Compound Name | 2-[3-(2-ethylhexylimino)-5,5-dimethylcyclohexen-1-yl]propanedinitrile |
|---|---|
| PubChem CID | 123137506 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | 2-[3-(2-ethylhexylimino)-5,5-dimethylcyclohexen-1-yl]propanedinitrile |
| SMILES | CCCCC(CC)C/N=C1\C=C(C(C#N)C#N)CC(C)(C)C1 |
| InChI | InChI=1S/C19H29N3/c1-5-7-8-15(6-2)14-22-18-9-16(17(12-20)13-21)10-19(3,4)11-18/h9,15,17H,5-8,10-11,14H2,1-4H3/b22-18+ |
| InChIKey | NBMFJWZEEZPLOR-RELWKKBWSA-N |
| XLogP | 5.05 |
| TPSA | 59.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|